C21H25ClN6 — CID 46887912
7-[(2-chlorophenyl)methyl]-5-piperidin-1-yl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridin-1-amine (PubChem CID 46887912) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-5-piperidin-1-yl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridin-1-amine.
| Compound Name | 7-[(2-chlorophenyl)methyl]-5-piperidin-1-yl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridin-1-amine |
|---|---|
| PubChem CID | 46887912 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-5-piperidin-1-yl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridin-1-amine |
| SMILES | Nc1[nH]nc2nc(N3CCCCC3)c3c(c12)CCN(Cc1ccccc1Cl)C3 |
| InChI | InChI=1S/C21H25ClN6/c22-17-7-3-2-6-14(17)12-27-11-8-15-16(13-27)21(28-9-4-1-5-10-28)24-20-18(15)19(23)25-26-20/h2-3,6-7H,1,4-5,8-13H2,(H3,23,24,25,26) |
| InChIKey | PNCSNZUBTJYTBH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |