C14H15N3O3S2 — CID 46887974
N-ethyl-2-phenylsulfanyl-5-sulfamoylpyridine-3-carboxamide (PubChem CID 46887974) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is N-ethyl-2-phenylsulfanyl-5-sulfamoylpyridine-3-carboxamide.
| Compound Name | N-ethyl-2-phenylsulfanyl-5-sulfamoylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46887974 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-ethyl-2-phenylsulfanyl-5-sulfamoylpyridine-3-carboxamide |
| SMILES | CCNC(=O)c1cc(S(N)(=O)=O)cnc1Sc1ccccc1 |
| InChI | InChI=1S/C14H15N3O3S2/c1-2-16-13(18)12-8-11(22(15,19)20)9-17-14(12)21-10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H,16,18)(H2,15,19,20) |
| InChIKey | PWAINXTYUTUOAR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |