About [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate
[2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate (PubChem CID 46888002) has the molecular formula C16H9F3N2O3S2
and a molecular weight of 398.39 g/mol. Its IUPAC name is [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 46888002 |
| Molecular Formula | C16H9F3N2O3S2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1nc2cc(-c3ccc(OS(=O)(=O)C(F)(F)F)c(C#N)c3)ccc2s1 |
| InChI | InChI=1S/C16H9F3N2O3S2/c1-9-21-13-7-11(3-5-15(13)25-9)10-2-4-14(12(6-10)8-20)24-26(22,23)16(17,18)19/h2-7H,1H3 |
| InChIKey | GXRHWBFQOVAGDT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate (CID 46888002) is [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate is Cc1nc2cc(-c3ccc(OS(=O)(=O)C(F)(F)F)c(C#N)c3)ccc2s1.
What is the InChIKey of [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is GXRHWBFQOVAGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9F3N2O3S2/c1-9-21-13-7-11(3-5-15(13)25-9)10-2-4-14(12(6-10)8-20)24-26(22,23)16(17,18)19/h2-7H,1H3.
What are the key properties of [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate?
[2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 398.39 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-4-(2-methyl-1,3-benzothiazol-5-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 46888002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).