C15H17N3O3S2 — CID 46888012
2-phenylsulfanyl-N-propyl-5-sulfamoylpyridine-3-carboxamide (PubChem CID 46888012) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-propyl-5-sulfamoylpyridine-3-carboxamide.
| Compound Name | 2-phenylsulfanyl-N-propyl-5-sulfamoylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46888012 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-phenylsulfanyl-N-propyl-5-sulfamoylpyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1cc(S(N)(=O)=O)cnc1Sc1ccccc1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-2-8-17-14(19)13-9-12(23(16,20)21)10-18-15(13)22-11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3,(H,17,19)(H2,16,20,21) |
| InChIKey | VMQRRWYNFJEGEJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |