C19H11N3S — CID 46888087
5-(1,3-benzothiazol-5-yl)-2-pyridin-3-ylbenzonitrile (PubChem CID 46888087) has the molecular formula C19H11N3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-5-yl)-2-pyridin-3-ylbenzonitrile.
| Compound Name | 5-(1,3-benzothiazol-5-yl)-2-pyridin-3-ylbenzonitrile |
|---|---|
| PubChem CID | 46888087 |
| Molecular Formula | C19H11N3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-(1,3-benzothiazol-5-yl)-2-pyridin-3-ylbenzonitrile |
| SMILES | N#Cc1cc(-c2ccc3scnc3c2)ccc1-c1cccnc1 |
| InChI | InChI=1S/C19H11N3S/c20-10-16-8-13(3-5-17(16)15-2-1-7-21-11-15)14-4-6-19-18(9-14)22-12-23-19/h1-9,11-12H |
| InChIKey | YINRDLFCSLEOLX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |