C23H16N4O4 — CID 46888110
methyl (1R,12S)-10-(5-cyano-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate (PubChem CID 46888110) has the molecular formula C23H16N4O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is methyl (1R,12S)-10-(5-cyano-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate.
| Compound Name | methyl (1R,12S)-10-(5-cyano-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
|---|---|
| PubChem CID | 46888110 |
| Molecular Formula | C23H16N4O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl (1R,12S)-10-(5-cyano-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)C(=O)C=C1N(C(=O)c3cc4cc(C#N)ccc4[nH]3)C[C@H]3C[C@]123 |
| InChI | InChI=1S/C23H16N4O4/c1-31-22(30)17-6-14-20(26-17)18(28)7-19-23(14)8-13(23)10-27(19)21(29)16-5-12-4-11(9-24)2-3-15(12)25-16/h2-7,13,25-26H,8,10H2,1H3/t13-,23-/m1/s1 |
| InChIKey | ZPYZFGVVHSFRIF-JCQPUDPBSA-N |
| XLogP | 2.65 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |