C25H37N3O8 — CID 46888140
[(2R)-1-[[2-[(3aR,4S,6R,6aS)-2,2-dimethyl-4-[[2-(phenylmethoxycarbonylamino)ethylamino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetyl]amino]propan-2-yl] acetate (PubChem CID 46888140) has the molecular formula C25H37N3O8 and a molecular weight of 507.58 g/mol. Its IUPAC name is [(2R)-1-[[2-[(3aR,4S,6R,6aS)-2,2-dimethyl-4-[[2-(phenylmethoxycarbonylamino)ethylamino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetyl]amino]propan-2-yl] acetate.
| Compound Name | [(2R)-1-[[2-[(3aR,4S,6R,6aS)-2,2-dimethyl-4-[[2-(phenylmethoxycarbonylamino)ethylamino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetyl]amino]propan-2-yl] acetate |
|---|---|
| PubChem CID | 46888140 |
| Molecular Formula | C25H37N3O8 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [(2R)-1-[[2-[(3aR,4S,6R,6aS)-2,2-dimethyl-4-[[2-(phenylmethoxycarbonylamino)ethylamino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetyl]amino]propan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)CNC(=O)C[C@H]1O[C@@H](CNCCNC(=O)OCc2ccccc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C25H37N3O8/c1-16(33-17(2)29)13-28-21(30)12-19-22-23(36-25(3,4)35-22)20(34-19)14-26-10-11-27-24(31)32-15-18-8-6-5-7-9-18/h5-9,16,19-20,22-23,26H,10-15H2,1-4H3,(H,27,31)(H,28,30)/t16-,19-,20+,22+,23-/m1/s1 |
| InChIKey | ZOYMTLNTOMQSPK-MMAASCIUSA-N |
| XLogP | 1.25 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|