C23H16F3N3O5 — CID 46888154
methyl (1R,12S)-7-oxo-10-[5-(trifluoromethoxy)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate (PubChem CID 46888154) has the molecular formula C23H16F3N3O5 and a molecular weight of 471.39 g/mol. Its IUPAC name is methyl (1R,12S)-7-oxo-10-[5-(trifluoromethoxy)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate.
| Compound Name | methyl (1R,12S)-7-oxo-10-[5-(trifluoromethoxy)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
|---|---|
| PubChem CID | 46888154 |
| Molecular Formula | C23H16F3N3O5 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | methyl (1R,12S)-7-oxo-10-[5-(trifluoromethoxy)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)C(=O)C=C1N(C(=O)c3cc4cc(OC(F)(F)F)ccc4[nH]3)C[C@H]3C[C@]123 |
| InChI | InChI=1S/C23H16F3N3O5/c1-33-21(32)16-6-13-19(28-16)17(30)7-18-22(13)8-11(22)9-29(18)20(31)15-5-10-4-12(34-23(24,25)26)2-3-14(10)27-15/h2-7,11,27-28H,8-9H2,1H3/t11-,22-/m1/s1 |
| InChIKey | JFUBVSYZIMIEHF-RKFFSXRUSA-N |
| XLogP | 3.68 |
| TPSA | 104.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |