C23H16F3N3O4 — CID 46888155
methyl (1R,12S)-7-oxo-10-[5-(trifluoromethyl)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate (PubChem CID 46888155) has the molecular formula C23H16F3N3O4 and a molecular weight of 455.39 g/mol. Its IUPAC name is methyl (1R,12S)-7-oxo-10-[5-(trifluoromethyl)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate.
| Compound Name | methyl (1R,12S)-7-oxo-10-[5-(trifluoromethyl)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
|---|---|
| PubChem CID | 46888155 |
| Molecular Formula | C23H16F3N3O4 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | methyl (1R,12S)-7-oxo-10-[5-(trifluoromethyl)-1H-indole-2-carbonyl]-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)C(=O)C=C1N(C(=O)c3cc4cc(C(F)(F)F)ccc4[nH]3)C[C@H]3C[C@]123 |
| InChI | InChI=1S/C23H16F3N3O4/c1-33-21(32)16-6-13-19(28-16)17(30)7-18-22(13)8-12(22)9-29(18)20(31)15-5-10-4-11(23(24,25)26)2-3-14(10)27-15/h2-7,12,27-28H,8-9H2,1H3/t12-,22-/m1/s1 |
| InChIKey | RKNGSYMRNKPXOR-VERVWZFWSA-N |
| XLogP | 3.80 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |