About 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid
4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 46888195) has the molecular formula C37H38F2O6
and a molecular weight of 616.70 g/mol. Its IUPAC name is 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
Molecular Properties
| Compound Name | 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| PubChem CID | 46888195 |
| Molecular Formula | C37H38F2O6 |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc(F)cc3)cc(-c3ccc(F)cc3)c2)c1CCC(=O)O |
| InChI | InChI=1S/C37H38F2O6/c38-31-15-11-26(12-16-31)29-23-30(27-13-17-32(39)18-14-27)25-33(24-29)44-21-4-2-1-3-7-28-8-5-9-35(34(28)19-20-37(42)43)45-22-6-10-36(40)41/h5,8-9,11-18,23-25H,1-4,6-7,10,19-22H2,(H,40,41)(H,42,43) |
| InChIKey | SIBQNRZKNGZZPW-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid?
The IUPAC name of 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (CID 46888195) is 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
What is the SMILES notation for 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid?
The canonical SMILES for 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid is O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc(F)cc3)cc(-c3ccc(F)cc3)c2)c1CCC(=O)O.
What is the InChIKey of 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid?
The InChIKey is SIBQNRZKNGZZPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H38F2O6/c38-31-15-11-26(12-16-31)29-23-30(27-13-17-32(39)18-14-27)25-33(24-29)44-21-4-2-1-3-7-28-8-5-9-35(34(28)19-20-37(42)43)45-22-6-10-36(40)41/h5,8-9,11-18,23-25H,1-4,6-7,10,19-22H2,(H,40,41)(H,42,43).
What are the key properties of 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid?
4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid has a molecular weight of 616.70 g/mol, XLogP of 8.74, 18 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[6-[3,5-bis(4-fluorophenyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid is sourced from PubChem (CID 46888195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).