C39H40O10 — CID 46888198
4-[3-[6-[3,5-bis(1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 46888198) has the molecular formula C39H40O10 and a molecular weight of 668.74 g/mol. Its IUPAC name is 4-[3-[6-[3,5-bis(1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3,5-bis(1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46888198 |
| Molecular Formula | C39H40O10 |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | 4-[3-[6-[3,5-bis(1,3-benzodioxol-5-yl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc4c(c3)OCO4)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O |
| InChI | InChI=1S/C39H40O10/c40-38(41)10-6-18-45-33-9-5-8-26(32(33)13-16-39(42)43)7-3-1-2-4-17-44-31-20-29(27-11-14-34-36(22-27)48-24-46-34)19-30(21-31)28-12-15-35-37(23-28)49-25-47-35/h5,8-9,11-12,14-15,19-23H,1-4,6-7,10,13,16-18,24-25H2,(H,40,41)(H,42,43) |
| InChIKey | ZSHBLZWJGIQZTM-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|