About (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate
(2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate (PubChem CID 46888231) has the molecular formula C15H14N4O3S
and a molecular weight of 330.37 g/mol. Its IUPAC name is (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate.
Molecular Properties
| Compound Name | (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate |
| PubChem CID | 46888231 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate |
| SMILES | Nc1ncc(COS(=O)(=O)c2ccc3ccccc3c2)c(N)n1 |
| InChI | InChI=1S/C15H14N4O3S/c16-14-12(8-18-15(17)19-14)9-22-23(20,21)13-6-5-10-3-1-2-4-11(10)7-13/h1-8H,9H2,(H4,16,17,18,19) |
| InChIKey | JAQUTSXRIMJXAY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate?
The IUPAC name of (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate (CID 46888231) is (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate.
What is the SMILES notation for (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate?
The canonical SMILES for (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate is Nc1ncc(COS(=O)(=O)c2ccc3ccccc3c2)c(N)n1.
What is the InChIKey of (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate?
The InChIKey is JAQUTSXRIMJXAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O3S/c16-14-12(8-18-15(17)19-14)9-22-23(20,21)13-6-5-10-3-1-2-4-11(10)7-13/h1-8H,9H2,(H4,16,17,18,19).
What are the key properties of (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate?
(2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate has a molecular weight of 330.37 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminopyrimidin-5-yl)methyl naphthalene-2-sulfonate is sourced from PubChem (CID 46888231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).