C27H31NO3S — CID 46888241
4-[(2R)-2-[[4-[(4-thiophen-3-ylphenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoic acid (PubChem CID 46888241) has the molecular formula C27H31NO3S and a molecular weight of 449.62 g/mol. Its IUPAC name is 4-[(2R)-2-[[4-[(4-thiophen-3-ylphenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoic acid.
| Compound Name | 4-[(2R)-2-[[4-[(4-thiophen-3-ylphenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 46888241 |
| Molecular Formula | C27H31NO3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[(2R)-2-[[4-[(4-thiophen-3-ylphenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCCC[C@@H]1COc1ccc(Cc2ccc(-c3ccsc3)cc2)cc1 |
| InChI | InChI=1S/C27H31NO3S/c29-27(30)5-3-16-28-15-2-1-4-25(28)19-31-26-12-8-22(9-13-26)18-21-6-10-23(11-7-21)24-14-17-32-20-24/h6-14,17,20,25H,1-5,15-16,18-19H2,(H,29,30)/t25-/m1/s1 |
| InChIKey | FQHGCKUMBBZBFX-RUZDIDTESA-N |
| XLogP | 6.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |