C22H16N4O6 — CID 46888262
methyl (1R,12S)-10-(5-nitro-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate (PubChem CID 46888262) has the molecular formula C22H16N4O6 and a molecular weight of 432.39 g/mol. Its IUPAC name is methyl (1R,12S)-10-(5-nitro-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate.
| Compound Name | methyl (1R,12S)-10-(5-nitro-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
|---|---|
| PubChem CID | 46888262 |
| Molecular Formula | C22H16N4O6 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | methyl (1R,12S)-10-(5-nitro-1H-indole-2-carbonyl)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)C(=O)C=C1N(C(=O)c3cc4cc([N+](=O)[O-])ccc4[nH]3)C[C@H]3C[C@]123 |
| InChI | InChI=1S/C22H16N4O6/c1-32-21(29)16-6-13-19(24-16)17(27)7-18-22(13)8-11(22)9-25(18)20(28)15-5-10-4-12(26(30)31)2-3-14(10)23-15/h2-7,11,23-24H,8-9H2,1H3/t11-,22-/m1/s1 |
| InChIKey | NJJYQRVLRFJPMA-RKFFSXRUSA-N |
| XLogP | 2.68 |
| TPSA | 138.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|