About 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine
5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine (PubChem CID 46888289) has the molecular formula C12H11N5OS
and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine |
| PubChem CID | 46888289 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(CSc2nc3ccccc3o2)c(N)n1 |
| InChI | InChI=1S/C12H11N5OS/c13-10-7(5-15-11(14)17-10)6-19-12-16-8-3-1-2-4-9(8)18-12/h1-5H,6H2,(H4,13,14,15,17) |
| InChIKey | NMGHQOQJIXHTTF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine (CID 46888289) is 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine is Nc1ncc(CSc2nc3ccccc3o2)c(N)n1.
What is the InChIKey of 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine?
The InChIKey is NMGHQOQJIXHTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5OS/c13-10-7(5-15-11(14)17-10)6-19-12-16-8-3-1-2-4-9(8)18-12/h1-5H,6H2,(H4,13,14,15,17).
What are the key properties of 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine?
5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine has a molecular weight of 273.32 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzoxazol-2-ylsulfanylmethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 46888289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).