C26H26Cl2O7 — CID 46888369
(4S,5R,6Z,9S,10S,12E)-16-[(3,4-dichlorophenyl)methoxy]-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 46888369) has the molecular formula C26H26Cl2O7 and a molecular weight of 521.39 g/mol. Its IUPAC name is (4S,5R,6Z,9S,10S,12E)-16-[(3,4-dichlorophenyl)methoxy]-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,9S,10S,12E)-16-[(3,4-dichlorophenyl)methoxy]-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 46888369 |
| Molecular Formula | C26H26Cl2O7 |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | (4S,5R,6Z,9S,10S,12E)-16-[(3,4-dichlorophenyl)methoxy]-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(OCc3ccc(Cl)c(Cl)c3)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C26H26Cl2O7/c1-14-6-9-22(30)25(32)21(29)5-3-4-17-11-18(12-23(31)24(17)26(33)35-15(14)2)34-13-16-7-8-19(27)20(28)10-16/h3-4,6-12,14-15,21,25,29,31-32H,5,13H2,1-2H3/b4-3+,9-6-/t14-,15+,21+,25+/m1/s1 |
| InChIKey | WVZJBKVQHTXHNN-OOQDPZOPSA-N |
| XLogP | 4.72 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |