C26H33N5O — CID 46888376
1,1-dimethyl-3-[3-[3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]isoquinolin-4-yl]propyl]urea (PubChem CID 46888376) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is 1,1-dimethyl-3-[3-[3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]isoquinolin-4-yl]propyl]urea.
| Compound Name | 1,1-dimethyl-3-[3-[3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]isoquinolin-4-yl]propyl]urea |
|---|---|
| PubChem CID | 46888376 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 1,1-dimethyl-3-[3-[3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]isoquinolin-4-yl]propyl]urea |
| SMILES | CN(C)C(=O)NCCCc1c(CN(C)[C@H]2CCCc3cccnc32)ncc2ccccc12 |
| InChI | InChI=1S/C26H33N5O/c1-30(2)26(32)28-16-8-13-22-21-12-5-4-9-20(21)17-29-23(22)18-31(3)24-14-6-10-19-11-7-15-27-25(19)24/h4-5,7,9,11-12,15,17,24H,6,8,10,13-14,16,18H2,1-3H3,(H,28,32)/t24-/m0/s1 |
| InChIKey | KEFWRLINBWLZQM-DEOSSOPVSA-N |
| XLogP | 4.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|