About [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid
[1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid (PubChem CID 46888417) has the molecular formula C16H17F2N2O6PS
and a molecular weight of 434.36 g/mol. Its IUPAC name is [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid.
Molecular Properties
| Compound Name | [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid |
| PubChem CID | 46888417 |
| Molecular Formula | C16H17F2N2O6PS |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid |
| SMILES | O=C1Nc2ccc(S(=O)(=O)NCCCCC(F)(F)P(=O)(O)O)c3cccc1c23 |
| InChI | InChI=1S/C16H17F2N2O6PS/c17-16(18,27(22,23)24)8-1-2-9-19-28(25,26)13-7-6-12-14-10(13)4-3-5-11(14)15(21)20-12/h3-7,19H,1-2,8-9H2,(H,20,21)(H2,22,23,24) |
| InChIKey | XJAMZKSEHMSRHJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid?
The IUPAC name of [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid (CID 46888417) is [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid.
What is the SMILES notation for [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid?
The canonical SMILES for [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid is O=C1Nc2ccc(S(=O)(=O)NCCCCC(F)(F)P(=O)(O)O)c3cccc1c23.
What is the InChIKey of [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid?
The InChIKey is XJAMZKSEHMSRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N2O6PS/c17-16(18,27(22,23)24)8-1-2-9-19-28(25,26)13-7-6-12-14-10(13)4-3-5-11(14)15(21)20-12/h3-7,19H,1-2,8-9H2,(H,20,21)(H2,22,23,24).
What are the key properties of [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid?
[1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid has a molecular weight of 434.36 g/mol, XLogP of 2.62, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-difluoro-5-[(2-oxo-1H-benzo[cd]indol-6-yl)sulfonylamino]pentyl]phosphonic acid is sourced from PubChem (CID 46888417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).