About 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile
2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile (PubChem CID 46888443) has the molecular formula C22H12F5N3O
and a molecular weight of 429.35 g/mol. Its IUPAC name is 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile |
| PubChem CID | 46888443 |
| Molecular Formula | C22H12F5N3O |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile |
| SMILES | N#Cc1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C22H12F5N3O/c23-17-3-5-18(6-4-17)30-20-8-2-16(10-14(20)12-29-30)21(31,22(25,26)27)15-1-7-19(24)13(9-15)11-28/h1-10,12,31H |
| InChIKey | DXRCWRDHBIVBIS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile?
The IUPAC name of 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile (CID 46888443) is 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile.
What is the SMILES notation for 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile?
The canonical SMILES for 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile is N#Cc1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)ccc1F.
What is the InChIKey of 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile?
The InChIKey is DXRCWRDHBIVBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12F5N3O/c23-17-3-5-18(6-4-17)30-20-8-2-16(10-14(20)12-29-30)21(31,22(25,26)27)15-1-7-19(24)13(9-15)11-28/h1-10,12,31H.
What are the key properties of 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile?
2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile has a molecular weight of 429.35 g/mol, XLogP of 4.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]benzonitrile is sourced from PubChem (CID 46888443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).