C24H36O5 — CID 46888463
[(1R,2R,3R,7R,8R,11S,14R)-14-acetyloxy-14-methyl-6,10-dimethylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl] acetate (PubChem CID 46888463) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is [(1R,2R,3R,7R,8R,11S,14R)-14-acetyloxy-14-methyl-6,10-dimethylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl] acetate.
| Compound Name | [(1R,2R,3R,7R,8R,11S,14R)-14-acetyloxy-14-methyl-6,10-dimethylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl] acetate |
|---|---|
| PubChem CID | 46888463 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [(1R,2R,3R,7R,8R,11S,14R)-14-acetyloxy-14-methyl-6,10-dimethylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl] acetate |
| SMILES | C=C1CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1CC(=C)[C@@H](OC(C)=O)CC[C@@](C)(OC(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C24H36O5/c1-13(2)18-9-8-14(3)21-20-12-15(4)19(27-16(5)25)10-11-24(7,29-17(6)26)23(28-20)22(18)21/h13,18-23H,3-4,8-12H2,1-2,5-7H3/t18-,19+,20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | VELCYHJGXHSUIL-UIFFHPIYSA-N |
| XLogP | 4.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|