C8H12BrNO4 — CID 46888469
[(1R,2R,5S,6S)-5-bromo-9-oxabicyclo[4.2.1]nonan-2-yl] nitrate (PubChem CID 46888469) has the molecular formula C8H12BrNO4 and a molecular weight of 266.09 g/mol. Its IUPAC name is [(1R,2R,5S,6S)-5-bromo-9-oxabicyclo[4.2.1]nonan-2-yl] nitrate.
| Compound Name | [(1R,2R,5S,6S)-5-bromo-9-oxabicyclo[4.2.1]nonan-2-yl] nitrate |
|---|---|
| PubChem CID | 46888469 |
| Molecular Formula | C8H12BrNO4 |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | [(1R,2R,5S,6S)-5-bromo-9-oxabicyclo[4.2.1]nonan-2-yl] nitrate |
| SMILES | O=[N+]([O-])O[C@@H]1CC[C@H](Br)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C8H12BrNO4/c9-5-1-2-8(14-10(11)12)7-4-3-6(5)13-7/h5-8H,1-4H2/t5-,6-,7+,8+/m0/s1 |
| InChIKey | KLUZIRRRZFQGPA-RULNZFCNSA-N |
| XLogP | 1.67 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|