C37H47N3O8S2 — CID 46888506
4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate (PubChem CID 46888506) has the molecular formula C37H47N3O8S2 and a molecular weight of 725.93 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate.
| Compound Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 46888506 |
| Molecular Formula | C37H47N3O8S2 |
| Molecular Weight | 725.93 g/mol |
| Exact Mass | 725.28 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccccc1C(=O)N[C@@H](C)C(=O)OCCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H47N3O8S2/c1-27(2)15-13-16-28(3)17-14-18-29(4)23-26-49-33-22-10-9-21-32(33)34(41)38-30(5)37(42)47-25-12-11-24-46-35-36(40(43)48-39-35)50(44,45)31-19-7-6-8-20-31/h6-10,15,17,19-23,30H,11-14,16,18,24-26H2,1-5H3,(H,38,41)/b28-17+,29-23+/t30-/m0/s1 |
| InChIKey | BGQCBRSBPIZVMD-QNKOPLAASA-N |
| XLogP | 7.17 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.93 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|