C36H45N3O8S2 — CID 46888510
4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl 2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]acetate (PubChem CID 46888510) has the molecular formula C36H45N3O8S2 and a molecular weight of 711.90 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl 2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]acetate.
| Compound Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl 2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]acetate |
|---|---|
| PubChem CID | 46888510 |
| Molecular Formula | C36H45N3O8S2 |
| Molecular Weight | 711.90 g/mol |
| Exact Mass | 711.26 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butyl 2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]acetate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccccc1C(=O)NCC(=O)OCCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H45N3O8S2/c1-27(2)14-12-15-28(3)16-13-17-29(4)22-25-48-32-21-9-8-20-31(32)34(41)37-26-33(40)45-23-10-11-24-46-35-36(39(42)47-38-35)49(43,44)30-18-6-5-7-19-30/h5-9,14,16,18-22H,10-13,15,17,23-26H2,1-4H3,(H,37,41)/b28-16+,29-22+ |
| InChIKey | IZQNCJMZWTYILS-IVEJOGDBSA-N |
| XLogP | 6.78 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.90 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|