C39H49N3O8S2 — CID 46888516
4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butan-2-yl (2S)-1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]pyrrolidine-2-carboxylate (PubChem CID 46888516) has the molecular formula C39H49N3O8S2 and a molecular weight of 751.97 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butan-2-yl (2S)-1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]pyrrolidine-2-carboxylate.
| Compound Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butan-2-yl (2S)-1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 46888516 |
| Molecular Formula | C39H49N3O8S2 |
| Molecular Weight | 751.97 g/mol |
| Exact Mass | 751.30 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butan-2-yl (2S)-1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccccc1C(=O)N1CCC[C@H]1C(=O)OC(C)CCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C39H49N3O8S2/c1-28(2)14-11-15-29(3)16-12-17-30(4)24-27-51-35-22-10-9-20-33(35)37(43)41-25-13-21-34(41)39(44)49-31(5)23-26-48-36-38(42(45)50-40-36)52(46,47)32-18-7-6-8-19-32/h6-10,14,16,18-20,22,24,31,34H,11-13,15,17,21,23,25-27H2,1-5H3/b29-16+,30-24+/t31?,34-/m0/s1 |
| InChIKey | BIZNEWHBFITJQR-YGMZGXMASA-N |
| XLogP | 7.66 |
| TPSA | 142.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.97 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|