C15H26 — CID 46888523
(4aS,8aS)-4,4,7,8,8a-pentamethyl-1,2,3,4a,5,6-hexahydronaphthalene (PubChem CID 46888523) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (4aS,8aS)-4,4,7,8,8a-pentamethyl-1,2,3,4a,5,6-hexahydronaphthalene.
| Compound Name | (4aS,8aS)-4,4,7,8,8a-pentamethyl-1,2,3,4a,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 46888523 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (4aS,8aS)-4,4,7,8,8a-pentamethyl-1,2,3,4a,5,6-hexahydronaphthalene |
| SMILES | CC1=C(C)[C@@]2(C)CCCC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C15H26/c1-11-7-8-13-14(3,4)9-6-10-15(13,5)12(11)2/h13H,6-10H2,1-5H3/t13-,15+/m0/s1 |
| InChIKey | VSURQKXDWDMWKL-DZGCQCFKSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|