C38H54N4O4 — CID 46888619
7,17-bis(1,5-dimethoxypentan-3-yl)-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin (PubChem CID 46888619) has the molecular formula C38H54N4O4 and a molecular weight of 630.87 g/mol. Its IUPAC name is 7,17-bis(1,5-dimethoxypentan-3-yl)-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 7,17-bis(1,5-dimethoxypentan-3-yl)-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 46888619 |
| Molecular Formula | C38H54N4O4 |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | 7,17-bis(1,5-dimethoxypentan-3-yl)-3,3,13,13-tetramethyl-2,12,22,24-tetrahydroporphyrin |
| SMILES | COCCC(CCOC)c1cc2cc3nc(cc4[nH]c(cc5nc(cc1[nH]2)C(C)(C)C5)cc4C(CCOC)CCOC)C(C)(C)C3 |
| InChI | InChI=1S/C38H54N4O4/c1-37(2)23-29-17-27-19-32(26(11-15-45-7)12-16-46-8)34(40-27)22-36-38(3,4)24-30(42-36)18-28-20-31(33(39-28)21-35(37)41-29)25(9-13-43-5)10-14-44-6/h17-22,25-26,39-40H,9-16,23-24H2,1-8H3/b27-17-,28-18-,29-17-,30-18-,33-21-,34-22-,35-21-,36-22- |
| InChIKey | ALKPRUOMACMYTA-VLMNSPEZSA-N |
| XLogP | 7.67 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |