C36H46Cl2N6 — CID 46888622
trimethyl-[3-[7,7,17,17-tetramethyl-12-[3-(trimethylazaniumyl)prop-1-ynyl]-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-ynyl]azanium dichloride (PubChem CID 46888622) has the molecular formula C36H46Cl2N6 and a molecular weight of 633.71 g/mol. Its IUPAC name is trimethyl-[3-[7,7,17,17-tetramethyl-12-[3-(trimethylazaniumyl)prop-1-ynyl]-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-ynyl]azanium dichloride.
| Compound Name | trimethyl-[3-[7,7,17,17-tetramethyl-12-[3-(trimethylazaniumyl)prop-1-ynyl]-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-ynyl]azanium dichloride |
|---|---|
| PubChem CID | 46888622 |
| Molecular Formula | C36H46Cl2N6 |
| Molecular Weight | 633.71 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | trimethyl-[3-[7,7,17,17-tetramethyl-12-[3-(trimethylazaniumyl)prop-1-ynyl]-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-ynyl]azanium dichloride |
| SMILES | CC1(C)Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C#CC[N+](C)(C)C)CC4(C)C)cc3C#CC[N+](C)(C)C.[Cl-].[Cl-] |
| InChI | InChI=1S/C36H46N6.2ClH/c1-35(2)23-29-19-31-26(14-12-16-42(8,9)10)18-28(38-31)22-34-36(3,4)24-30(40-34)20-32-25(13-11-15-41(5,6)7)17-27(37-32)21-33(35)39-29;;/h17-22,37-38H,15-16,23-24H2,1-10H3;2*1H/q+2;;/p-2/b27-21-,28-22-,29-19-,30-20-,31-19-,32-20-,33-21-,34-22-;; |
| InChIKey | RPHFHEVOELQCQJ-YVHYJOIESA-L |
| XLogP | -0.52 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.71 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|