C38H52Cl2N8O2 — CID 46888627
[12-(4,4-dimethylpiperazin-4-ium-1-carbonyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-(4,4-dimethylpiperazin-4-ium-1-yl)methanone dichloride (PubChem CID 46888627) has the molecular formula C38H52Cl2N8O2 and a molecular weight of 723.79 g/mol. Its IUPAC name is [12-(4,4-dimethylpiperazin-4-ium-1-carbonyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-(4,4-dimethylpiperazin-4-ium-1-yl)methanone dichloride.
| Compound Name | [12-(4,4-dimethylpiperazin-4-ium-1-carbonyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-(4,4-dimethylpiperazin-4-ium-1-yl)methanone dichloride |
|---|---|
| PubChem CID | 46888627 |
| Molecular Formula | C38H52Cl2N8O2 |
| Molecular Weight | 723.79 g/mol |
| Exact Mass | 722.36 |
| IUPAC Name | [12-(4,4-dimethylpiperazin-4-ium-1-carbonyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-(4,4-dimethylpiperazin-4-ium-1-yl)methanone dichloride |
| SMILES | CC1(C)Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C(=O)N1CC[N+](C)(C)CC1)CC4(C)C)cc3C(=O)N1CC[N+](C)(C)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C38H51N8O2.2ClH/c1-37(2)23-27-19-31-30(36(48)44-11-15-46(7,8)16-12-44)18-26(40-31)22-34-38(3,4)24-28(42-34)20-32-29(17-25(39-32)21-33(37)41-27)35(47)43-9-13-45(5,6)14-10-43;;/h17-22H,9-16,23-24H2,1-8H3,(H-,39,40,41,42,47,48);2*1H/q+1;;/p-1 |
| InChIKey | NKVQLNRAWMROCK-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.79 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|