C42H38N4O6 — CID 46888629
(E)-3-(3,5-dihydroxyphenyl)-1-[12-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-en-1-one (PubChem CID 46888629) has the molecular formula C42H38N4O6 and a molecular weight of 694.79 g/mol. Its IUPAC name is (E)-3-(3,5-dihydroxyphenyl)-1-[12-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dihydroxyphenyl)-1-[12-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46888629 |
| Molecular Formula | C42H38N4O6 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | (E)-3-(3,5-dihydroxyphenyl)-1-[12-[(E)-3-(3,5-dihydroxyphenyl)prop-2-enoyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]prop-2-en-1-one |
| SMILES | CC1(C)Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C(=O)/C=C/c1cc(O)cc(O)c1)CC4(C)C)cc3C(=O)/C=C/c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C42H38N4O6/c1-41(2)21-27-15-35-34(38(52)8-6-24-11-31(49)20-32(50)12-24)14-26(44-35)18-40-42(3,4)22-28(46-40)16-36-33(13-25(43-36)17-39(41)45-27)37(51)7-5-23-9-29(47)19-30(48)10-23/h5-20,43-44,47-50H,21-22H2,1-4H3/b7-5+,8-6+,25-17-,26-18-,27-15-,28-16-,35-15-,36-16-,39-17-,40-18- |
| InChIKey | HVVMSIDZVJYXDV-DSVJUWLASA-N |
| XLogP | 7.97 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|