C19H26N4 — CID 46888654
N'-(pyridin-2-ylmethyl)-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 46888654) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is N'-(pyridin-2-ylmethyl)-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N'-(pyridin-2-ylmethyl)-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 46888654 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N'-(pyridin-2-ylmethyl)-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | NCCCCN(Cc1ccccn1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C19H26N4/c20-11-2-4-14-23(15-17-9-1-3-12-21-17)18-10-5-7-16-8-6-13-22-19(16)18/h1,3,6,8-9,12-13,18H,2,4-5,7,10-11,14-15,20H2 |
| InChIKey | VGHVNBUMMIDEEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|