C17H24N4S — CID 46888704
N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine (PubChem CID 46888704) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine.
| Compound Name | N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 46888704 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N'-(5,6,7,8-tetrahydroquinolin-8-yl)-N'-(1,3-thiazol-2-ylmethyl)butane-1,4-diamine |
| SMILES | NCCCCN(Cc1nccs1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C17H24N4S/c18-8-1-2-11-21(13-16-19-10-12-22-16)15-7-3-5-14-6-4-9-20-17(14)15/h4,6,9-10,12,15H,1-3,5,7-8,11,13,18H2 |
| InChIKey | SZUYXHOPFGTSPW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|