C28H25Cl3N4O2 — CID 46888778
N-[(4R)-6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 46888778) has the molecular formula C28H25Cl3N4O2 and a molecular weight of 555.89 g/mol. Its IUPAC name is N-[(4R)-6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(4R)-6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46888778 |
| Molecular Formula | C28H25Cl3N4O2 |
| Molecular Weight | 555.89 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | N-[(4R)-6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)N[C@@H]1CC(C)(C)Oc2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C28H25Cl3N4O2/c1-14-24(15(2)35-34-14)26(36)32-23-13-28(3,4)37-27-21(23)12-20(16-5-7-17(29)8-6-16)25(33-27)19-10-9-18(30)11-22(19)31/h5-12,23H,13H2,1-4H3,(H,32,36)(H,34,35)/t23-/m1/s1 |
| InChIKey | ASISOGRWKOFTRC-HSZRJFAPSA-N |
| XLogP | 7.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.89 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |