C21H26N2O6 — CID 46888849
diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]butanedioate (PubChem CID 46888849) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]butanedioate.
| Compound Name | diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]butanedioate |
|---|---|
| PubChem CID | 46888849 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]butanedioate |
| SMILES | CCOC(=O)C[C@@H](C(=O)OCC)N1C(=O)[C@H]2CN(Cc3ccccc3)C[C@H]2C1=O |
| InChI | InChI=1S/C21H26N2O6/c1-3-28-18(24)10-17(21(27)29-4-2)23-19(25)15-12-22(13-16(15)20(23)26)11-14-8-6-5-7-9-14/h5-9,15-17H,3-4,10-13H2,1-2H3/t15-,16+,17-/m0/s1 |
| InChIKey | DBYKNMLRRAKVJD-BBWFWOEESA-N |
| XLogP | 0.99 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|