About 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide
4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 46888875) has the molecular formula C13H13Cl2O3P
and a molecular weight of 319.12 g/mol. Its IUPAC name is 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide.
Molecular Properties
| Compound Name | 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide |
| PubChem CID | 46888875 |
| Molecular Formula | C13H13Cl2O3P |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCOP1(=O)OC(C2CC2)=C(Cl)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H13Cl2O3P/c1-2-17-19(16)11-7-9(14)5-6-10(11)12(15)13(18-19)8-3-4-8/h5-8H,2-4H2,1H3 |
| InChIKey | ONRDQWHAQYOZKI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide?
The IUPAC name of 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide (CID 46888875) is 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide.
What is the SMILES notation for 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide?
The canonical SMILES for 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide is CCOP1(=O)OC(C2CC2)=C(Cl)c2ccc(Cl)cc21.
What is the InChIKey of 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide?
The InChIKey is ONRDQWHAQYOZKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2O3P/c1-2-17-19(16)11-7-9(14)5-6-10(11)12(15)13(18-19)8-3-4-8/h5-8H,2-4H2,1H3.
What are the key properties of 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide?
4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide has a molecular weight of 319.12 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dichloro-3-cyclopropyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide is sourced from PubChem (CID 46888875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).