C22H28N2O6 — CID 46888878
diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pentanedioate (PubChem CID 46888878) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pentanedioate.
| Compound Name | diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pentanedioate |
|---|---|
| PubChem CID | 46888878 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | diethyl (2S)-2-[(3aS,6aR)-2-benzyl-4,6-dioxo-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](C(=O)OCC)N1C(=O)[C@H]2CN(Cc3ccccc3)C[C@H]2C1=O |
| InChI | InChI=1S/C22H28N2O6/c1-3-29-19(25)11-10-18(22(28)30-4-2)24-20(26)16-13-23(14-17(16)21(24)27)12-15-8-6-5-7-9-15/h5-9,16-18H,3-4,10-14H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | BKCAIGOBYJJPOQ-KSZLIROESA-N |
| XLogP | 1.38 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|