C20H22FN3 — CID 46888882
1-[(4-fluorophenyl)methyl]-2-[(3S)-1-methylpiperidin-3-yl]benzimidazole (PubChem CID 46888882) has the molecular formula C20H22FN3 and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-[(3S)-1-methylpiperidin-3-yl]benzimidazole.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-[(3S)-1-methylpiperidin-3-yl]benzimidazole |
|---|---|
| PubChem CID | 46888882 |
| Molecular Formula | C20H22FN3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-[(3S)-1-methylpiperidin-3-yl]benzimidazole |
| SMILES | CN1CCC[C@H](c2nc3ccccc3n2Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H22FN3/c1-23-12-4-5-16(14-23)20-22-18-6-2-3-7-19(18)24(20)13-15-8-10-17(21)11-9-15/h2-3,6-11,16H,4-5,12-14H2,1H3/t16-/m0/s1 |
| InChIKey | AXIFLPLKZRNVDP-INIZCTEOSA-N |
| XLogP | 4.03 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |