About 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one
2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one (PubChem CID 46888929) has the molecular formula C14H8N4OS
and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one |
| PubChem CID | 46888929 |
| Molecular Formula | C14H8N4OS |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one |
| SMILES | Nc1nc(-c2nccs2)c2c(n1)-c1ccccc1C2=O |
| InChI | InChI=1S/C14H8N4OS/c15-14-17-10-7-3-1-2-4-8(7)12(19)9(10)11(18-14)13-16-5-6-20-13/h1-6H,(H2,15,17,18) |
| InChIKey | CDCCTZJZHTUCLT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one?
The IUPAC name of 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one (CID 46888929) is 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one.
What is the SMILES notation for 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one?
The canonical SMILES for 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one is Nc1nc(-c2nccs2)c2c(n1)-c1ccccc1C2=O.
What is the InChIKey of 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one?
The InChIKey is CDCCTZJZHTUCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4OS/c15-14-17-10-7-3-1-2-4-8(7)12(19)9(10)11(18-14)13-16-5-6-20-13/h1-6H,(H2,15,17,18).
What are the key properties of 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one?
2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one has a molecular weight of 280.31 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(1,3-thiazol-2-yl)indeno[1,2-d]pyrimidin-5-one is sourced from PubChem (CID 46888929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).