About N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine
N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine (PubChem CID 46889000) has the molecular formula C21H25ClN4
and a molecular weight of 368.91 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine |
| PubChem CID | 46889000 |
| Molecular Formula | C21H25ClN4 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine |
| SMILES | CCCN(CCCNc1ccnc2cc(Cl)ccc12)Cc1ccccn1 |
| InChI | InChI=1S/C21H25ClN4/c1-2-13-26(16-18-6-3-4-10-23-18)14-5-11-24-20-9-12-25-21-15-17(22)7-8-19(20)21/h3-4,6-10,12,15H,2,5,11,13-14,16H2,1H3,(H,24,25) |
| InChIKey | YNSCZKKJGZTEAH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine?
The IUPAC name of N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine (CID 46889000) is N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine is CCCN(CCCNc1ccnc2cc(Cl)ccc12)Cc1ccccn1.
What is the InChIKey of N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine?
The InChIKey is YNSCZKKJGZTEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25ClN4/c1-2-13-26(16-18-6-3-4-10-23-18)14-5-11-24-20-9-12-25-21-15-17(22)7-8-19(20)21/h3-4,6-10,12,15H,2,5,11,13-14,16H2,1H3,(H,24,25).
What are the key properties of N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine?
N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine has a molecular weight of 368.91 g/mol, XLogP of 5.00, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-chloroquinolin-4-yl)-N'-propyl-N'-(pyridin-2-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 46889000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).