About 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile
4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile (PubChem CID 46889034) has the molecular formula C24H22Cl2N4O
and a molecular weight of 453.37 g/mol. Its IUPAC name is 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile |
| PubChem CID | 46889034 |
| Molecular Formula | C24H22Cl2N4O |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(/C=C/CCN3CCOCC3)ccc2c1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N4O/c25-19-5-7-22(21(26)14-19)29-24-18(15-27)16-28-23-13-17(4-6-20(23)24)3-1-2-8-30-9-11-31-12-10-30/h1,3-7,13-14,16H,2,8-12H2,(H,28,29)/b3-1+ |
| InChIKey | ZBLVBVCAWDAQOR-HNQUOIGGSA-N |
| XLogP | 5.89 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile?
The IUPAC name of 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile (CID 46889034) is 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile.
What is the SMILES notation for 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile?
The canonical SMILES for 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile is N#Cc1cnc2cc(/C=C/CCN3CCOCC3)ccc2c1Nc1ccc(Cl)cc1Cl.
What is the InChIKey of 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile?
The InChIKey is ZBLVBVCAWDAQOR-HNQUOIGGSA-N. The full InChI is InChI=1S/C24H22Cl2N4O/c25-19-5-7-22(21(26)14-19)29-24-18(15-27)16-28-23-13-17(4-6-20(23)24)3-1-2-8-30-9-11-31-12-10-30/h1,3-7,13-14,16H,2,8-12H2,(H,28,29)/b3-1+.
What are the key properties of 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile?
4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile has a molecular weight of 453.37 g/mol, XLogP of 5.89, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichloroanilino)-7-[(E)-4-morpholin-4-ylbut-1-enyl]quinoline-3-carbonitrile is sourced from PubChem (CID 46889034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).