C20H20FN7O4 — CID 46889094
1-cyclopropyl-6-fluoro-7-[4-[4-[(E)-hydroxyiminomethyl]triazol-1-yl]piperidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 46889094) has the molecular formula C20H20FN7O4 and a molecular weight of 441.42 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[4-[4-[(E)-hydroxyiminomethyl]triazol-1-yl]piperidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[4-[4-[(E)-hydroxyiminomethyl]triazol-1-yl]piperidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 46889094 |
| Molecular Formula | C20H20FN7O4 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[4-[4-[(E)-hydroxyiminomethyl]triazol-1-yl]piperidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2nc(N3CCC(n4cc(/C=N/O)nn4)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C20H20FN7O4/c21-16-7-14-17(29)15(20(30)31)10-27(12-1-2-12)18(14)23-19(16)26-5-3-13(4-6-26)28-9-11(8-22-32)24-25-28/h7-10,12-13,32H,1-6H2,(H,30,31)/b22-8+ |
| InChIKey | CSHFQKPLSHXTPD-GZIVZEMBSA-N |
| XLogP | 1.81 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|