C17H24OS — CID 46889227
(E)-2-thiophen-3-yl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol (PubChem CID 46889227) has the molecular formula C17H24OS and a molecular weight of 276.44 g/mol. Its IUPAC name is (E)-2-thiophen-3-yl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol.
| Compound Name | (E)-2-thiophen-3-yl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 46889227 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (E)-2-thiophen-3-yl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(C)(O)c1ccsc1 |
| InChI | InChI=1S/C17H24OS/c1-13-6-5-9-16(2,3)15(13)7-10-17(4,18)14-8-11-19-12-14/h6-8,10-12,15,18H,5,9H2,1-4H3/b10-7+ |
| InChIKey | KDCJSWWEOMMHQM-JXMROGBWSA-N |
| XLogP | 4.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|