C23H33N3O2 — CID 46889233
(2R)-1-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]piperidine-2-carboxylic acid (PubChem CID 46889233) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (2R)-1-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 46889233 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (2R)-1-[4-[2-[5-(2,2-dimethylbutyl)-1H-imidazol-2-yl]ethyl]phenyl]piperidine-2-carboxylic acid |
| SMILES | CCC(C)(C)Cc1cnc(CCc2ccc(N3CCCC[C@@H]3C(=O)O)cc2)[nH]1 |
| InChI | InChI=1S/C23H33N3O2/c1-4-23(2,3)15-18-16-24-21(25-18)13-10-17-8-11-19(12-9-17)26-14-6-5-7-20(26)22(27)28/h8-9,11-12,16,20H,4-7,10,13-15H2,1-3H3,(H,24,25)(H,27,28)/t20-/m1/s1 |
| InChIKey | HBUOBPDQRHXPRD-HXUWFJFHSA-N |
| XLogP | 4.62 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|