About benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate
benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 46889312) has the molecular formula C16H20N2O4S
and a molecular weight of 336.41 g/mol. Its IUPAC name is benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate |
| PubChem CID | 46889312 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | O=C([C@@H]1CCCN1C(=O)OCc1ccccc1)N1CCS(=O)C1 |
| InChI | InChI=1S/C16H20N2O4S/c19-15(17-9-10-23(21)12-17)14-7-4-8-18(14)16(20)22-11-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2/t14-,23?/m0/s1 |
| InChIKey | BEKYTVSHBMXCAV-JRQMZCAUSA-N |
| XLogP | 1.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate (CID 46889312) is benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate is O=C([C@@H]1CCCN1C(=O)OCc1ccccc1)N1CCS(=O)C1.
What is the InChIKey of benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
The InChIKey is BEKYTVSHBMXCAV-JRQMZCAUSA-N. The full InChI is InChI=1S/C16H20N2O4S/c19-15(17-9-10-23(21)12-17)14-7-4-8-18(14)16(20)22-11-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2/t14-,23?/m0/s1.
What are the key properties of benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate has a molecular weight of 336.41 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-(1-oxo-1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 46889312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).