C25H24N4O2 — CID 46889346
20-methyl-7-(oxan-2-yl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one (PubChem CID 46889346) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 20-methyl-7-(oxan-2-yl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one.
| Compound Name | 20-methyl-7-(oxan-2-yl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one |
|---|---|
| PubChem CID | 46889346 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 20-methyl-7-(oxan-2-yl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one |
| SMILES | Cn1ncc2c1CCc1c-2c2c(c3c1[nH]c1ccc(C4CCCCO4)cc13)CNC2=O |
| InChI | InChI=1S/C25H24N4O2/c1-29-19-8-6-14-21(16(19)12-27-29)23-17(11-26-25(23)30)22-15-10-13(20-4-2-3-9-31-20)5-7-18(15)28-24(14)22/h5,7,10,12,20,28H,2-4,6,8-9,11H2,1H3,(H,26,30) |
| InChIKey | XDDKJJLWQBEZES-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |