C19H22FNO3S — CID 46889350
2-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol (PubChem CID 46889350) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol.
| Compound Name | 2-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 46889350 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol |
| SMILES | O=S(=O)(c1cccc(F)c1)c1ccc2c(c1)CCC[C@H]2CNCCO |
| InChI | InChI=1S/C19H22FNO3S/c20-16-5-2-6-17(12-16)25(23,24)18-7-8-19-14(11-18)3-1-4-15(19)13-21-9-10-22/h2,5-8,11-12,15,21-22H,1,3-4,9-10,13H2/t15-/m0/s1 |
| InChIKey | OSRIONOQBURAGV-HNNXBMFYSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|