C20H24FNO5S2 — CID 46889352
3-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]propane-1-sulfonic acid (PubChem CID 46889352) has the molecular formula C20H24FNO5S2 and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]propane-1-sulfonic acid.
| Compound Name | 3-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 46889352 |
| Molecular Formula | C20H24FNO5S2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 3-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNC[C@@H]1CCCc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C20H24FNO5S2/c21-17-6-2-7-18(13-17)29(26,27)19-8-9-20-15(12-19)4-1-5-16(20)14-22-10-3-11-28(23,24)25/h2,6-9,12-13,16,22H,1,3-5,10-11,14H2,(H,23,24,25)/t16-/m0/s1 |
| InChIKey | FKWJERRBVKVXJN-INIZCTEOSA-N |
| XLogP | 2.95 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|