About 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine
2-bromo-5,6-dihydrobenzo[c]acridin-7-amine (PubChem CID 46889356) has the molecular formula C17H13BrN2
and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine.
Molecular Properties
| Compound Name | 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine |
| PubChem CID | 46889356 |
| Molecular Formula | C17H13BrN2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine |
| SMILES | Nc1c2c(nc3ccccc13)-c1cc(Br)ccc1CC2 |
| InChI | InChI=1S/C17H13BrN2/c18-11-7-5-10-6-8-13-16(19)12-3-1-2-4-15(12)20-17(13)14(10)9-11/h1-5,7,9H,6,8H2,(H2,19,20) |
| InChIKey | ZHCIZNYIQLXSOR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine?
The IUPAC name of 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine (CID 46889356) is 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine.
What is the SMILES notation for 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine?
The canonical SMILES for 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine is Nc1c2c(nc3ccccc13)-c1cc(Br)ccc1CC2.
What is the InChIKey of 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine?
The InChIKey is ZHCIZNYIQLXSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2/c18-11-7-5-10-6-8-13-16(19)12-3-1-2-4-15(12)20-17(13)14(10)9-11/h1-5,7,9H,6,8H2,(H2,19,20).
What are the key properties of 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine?
2-bromo-5,6-dihydrobenzo[c]acridin-7-amine has a molecular weight of 325.21 g/mol, XLogP of 4.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5,6-dihydrobenzo[c]acridin-7-amine is sourced from PubChem (CID 46889356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).