C21H22O12 — CID 46889394
6-methoxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-1,2,5,7,9,10-hexol (PubChem CID 46889394) has the molecular formula C21H22O12 and a molecular weight of 466.40 g/mol. Its IUPAC name is 6-methoxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-1,2,5,7,9,10-hexol.
| Compound Name | 6-methoxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-1,2,5,7,9,10-hexol |
|---|---|
| PubChem CID | 46889394 |
| Molecular Formula | C21H22O12 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 6-methoxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-1,2,5,7,9,10-hexol |
| SMILES | COc1c(O)cc2c(O)c3c(O)c(O)c(O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)cc3c(O)c2c1O |
| InChI | InChI=1S/C21H22O12/c1-5-12(23)18(29)19(30)21(32-5)33-9-4-7-10(16(27)15(9)26)13(24)6-3-8(22)20(31-2)17(28)11(6)14(7)25/h3-5,12,18-19,21-30H,1-2H3/t5-,12-,18+,19+,21-/m0/s1 |
| InChIKey | QLOFOYWGICCJNV-CQVRPWGASA-N |
| XLogP | 0.44 |
| TPSA | 209.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|