C27H26ClF6N3O2 — CID 46889466
2-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(2-chlorophenyl)-6-(2-methoxyethylamino)-3-pyridinyl]-N,2-dimethylpropanamide (PubChem CID 46889466) has the molecular formula C27H26ClF6N3O2 and a molecular weight of 573.97 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(2-chlorophenyl)-6-(2-methoxyethylamino)-3-pyridinyl]-N,2-dimethylpropanamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(2-chlorophenyl)-6-(2-methoxyethylamino)-3-pyridinyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 46889466 |
| Molecular Formula | C27H26ClF6N3O2 |
| Molecular Weight | 573.97 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[4-(2-chlorophenyl)-6-(2-methoxyethylamino)-3-pyridinyl]-N,2-dimethylpropanamide |
| SMILES | COCCNc1cc(-c2ccccc2Cl)c(N(C)C(=O)C(C)(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C27H26ClF6N3O2/c1-25(2,16-11-17(26(29,30)31)13-18(12-16)27(32,33)34)24(38)37(3)22-15-36-23(35-9-10-39-4)14-20(22)19-7-5-6-8-21(19)28/h5-8,11-15H,9-10H2,1-4H3,(H,35,36) |
| InChIKey | KPSHRAGASWDIHK-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.97 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|