C31H41N5O4S2 — CID 46889663
6-methyl-N-[1-[[(2S)-1-phenyl-5-(4-sulfamoylpiperazin-1-yl)pentan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide (PubChem CID 46889663) has the molecular formula C31H41N5O4S2 and a molecular weight of 611.83 g/mol. Its IUPAC name is 6-methyl-N-[1-[[(2S)-1-phenyl-5-(4-sulfamoylpiperazin-1-yl)pentan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 6-methyl-N-[1-[[(2S)-1-phenyl-5-(4-sulfamoylpiperazin-1-yl)pentan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46889663 |
| Molecular Formula | C31H41N5O4S2 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 6-methyl-N-[1-[[(2S)-1-phenyl-5-(4-sulfamoylpiperazin-1-yl)pentan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NC3(C(=O)N[C@@H](CCCN4CCN(S(N)(=O)=O)CC4)Cc4ccccc4)CCCC3)sc2c1 |
| InChI | InChI=1S/C31H41N5O4S2/c1-23-11-12-25-22-28(41-27(25)20-23)29(37)34-31(13-5-6-14-31)30(38)33-26(21-24-8-3-2-4-9-24)10-7-15-35-16-18-36(19-17-35)42(32,39)40/h2-4,8-9,11-12,20,22,26H,5-7,10,13-19,21H2,1H3,(H,33,38)(H,34,37)(H2,32,39,40)/t26-/m0/s1 |
| InChIKey | ZLJOAFCXAUKYOF-SANMLTNESA-N |
| XLogP | 3.58 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |